C30H30ClN3O3S — CID 18842567
(5Z)-5-[[4-[(2-chlorophenyl)methoxy]-3-ethoxyphenyl]methylidene]-3-cyclohexyl-2-pyridin-3-ylimino-1,3-thiazolidin-4-one (PubChem CID 18842567) has the molecular formula C30H30ClN3O3S and a molecular weight of 548.11 g/mol. Its IUPAC name is (5Z)-5-[[4-[(2-chlorophenyl)methoxy]-3-ethoxyphenyl]methylidene]-3-cyclohexyl-2-pyridin-3-ylimino-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-5-[[4-[(2-chlorophenyl)methoxy]-3-ethoxyphenyl]methylidene]-3-cyclohexyl-2-pyridin-3-ylimino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 18842567 |
| Molecular Formula | C30H30ClN3O3S |
| Molecular Weight | 548.11 g/mol |
| Exact Mass | 547.17 |
| IUPAC Name | (5Z)-5-[[4-[(2-chlorophenyl)methoxy]-3-ethoxyphenyl]methylidene]-3-cyclohexyl-2-pyridin-3-ylimino-1,3-thiazolidin-4-one |
| SMILES | CCOc1cc(/C=C2\S/C(=N\c3cccnc3)N(C3CCCCC3)C2=O)ccc1OCc1ccccc1Cl |
| InChI | InChI=1S/C30H30ClN3O3S/c1-2-36-27-17-21(14-15-26(27)37-20-22-9-6-7-13-25(22)31)18-28-29(35)34(24-11-4-3-5-12-24)30(38-28)33-23-10-8-16-32-19-23/h6-10,13-19,24H,2-5,11-12,20H2,1H3/b28-18-,33-30- |
| InChIKey | NHVARPHICVUERU-SYAIXCBXSA-N |
| XLogP | 7.65 |
| TPSA | 64.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.11 |
| LogP ≤ 5 | 7.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|