C21H21N3O2S — CID 18842544
(5Z)-3-cyclohexyl-5-[(4-hydroxyphenyl)methylidene]-2-pyridin-3-ylimino-1,3-thiazolidin-4-one (PubChem CID 18842544) has the molecular formula C21H21N3O2S and a molecular weight of 379.49 g/mol. Its IUPAC name is (5Z)-3-cyclohexyl-5-[(4-hydroxyphenyl)methylidene]-2-pyridin-3-ylimino-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-3-cyclohexyl-5-[(4-hydroxyphenyl)methylidene]-2-pyridin-3-ylimino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 18842544 |
| Molecular Formula | C21H21N3O2S |
| Molecular Weight | 379.49 g/mol |
| Exact Mass | 379.14 |
| IUPAC Name | (5Z)-3-cyclohexyl-5-[(4-hydroxyphenyl)methylidene]-2-pyridin-3-ylimino-1,3-thiazolidin-4-one |
| SMILES | O=C1/C(=C/c2ccc(O)cc2)S/C(=N\c2cccnc2)N1C1CCCCC1 |
| InChI | InChI=1S/C21H21N3O2S/c25-18-10-8-15(9-11-18)13-19-20(26)24(17-6-2-1-3-7-17)21(27-19)23-16-5-4-12-22-14-16/h4-5,8-14,17,25H,1-3,6-7H2/b19-13-,23-21- |
| InChIKey | TXHAVOUQZBRUFT-QFGKFHJGSA-N |
| XLogP | 4.72 |
| TPSA | 65.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.49 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|