C30H28N2O4S — CID 21212556
4-[[4-[(Z)-(3-cyclohexyl-4-oxo-2-phenylimino-1,3-thiazolidin-5-ylidene)methyl]phenoxy]methyl]benzoic acid (PubChem CID 21212556) has the molecular formula C30H28N2O4S and a molecular weight of 512.63 g/mol. Its IUPAC name is 4-[[4-[(Z)-(3-cyclohexyl-4-oxo-2-phenylimino-1,3-thiazolidin-5-ylidene)methyl]phenoxy]methyl]benzoic acid.
| Compound Name | 4-[[4-[(Z)-(3-cyclohexyl-4-oxo-2-phenylimino-1,3-thiazolidin-5-ylidene)methyl]phenoxy]methyl]benzoic acid |
|---|---|
| PubChem CID | 21212556 |
| Molecular Formula | C30H28N2O4S |
| Molecular Weight | 512.63 g/mol |
| Exact Mass | 512.18 |
| IUPAC Name | 4-[[4-[(Z)-(3-cyclohexyl-4-oxo-2-phenylimino-1,3-thiazolidin-5-ylidene)methyl]phenoxy]methyl]benzoic acid |
| SMILES | O=C(O)c1ccc(COc2ccc(/C=C3\S/C(=N\c4ccccc4)N(C4CCCCC4)C3=O)cc2)cc1 |
| InChI | InChI=1S/C30H28N2O4S/c33-28-27(37-30(31-24-7-3-1-4-8-24)32(28)25-9-5-2-6-10-25)19-21-13-17-26(18-14-21)36-20-22-11-15-23(16-12-22)29(34)35/h1,3-4,7-8,11-19,25H,2,5-6,9-10,20H2,(H,34,35)/b27-19-,31-30- |
| InChIKey | BSVOXJYPKYMRJI-UQLAIIKNSA-N |
| XLogP | 6.90 |
| TPSA | 79.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.63 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|