C25H24N2O5S — CID 18846639
3-[[(5Z)-3-cyclohexyl-5-[(4-methoxycarbonylphenyl)methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoic acid (PubChem CID 18846639) has the molecular formula C25H24N2O5S and a molecular weight of 464.54 g/mol. Its IUPAC name is 3-[[(5Z)-3-cyclohexyl-5-[(4-methoxycarbonylphenyl)methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoic acid.
| Compound Name | 3-[[(5Z)-3-cyclohexyl-5-[(4-methoxycarbonylphenyl)methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoic acid |
|---|---|
| PubChem CID | 18846639 |
| Molecular Formula | C25H24N2O5S |
| Molecular Weight | 464.54 g/mol |
| Exact Mass | 464.14 |
| IUPAC Name | 3-[[(5Z)-3-cyclohexyl-5-[(4-methoxycarbonylphenyl)methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoic acid |
| SMILES | COC(=O)c1ccc(/C=C2\S/C(=N\c3cccc(C(=O)O)c3)N(C3CCCCC3)C2=O)cc1 |
| InChI | InChI=1S/C25H24N2O5S/c1-32-24(31)17-12-10-16(11-13-17)14-21-22(28)27(20-8-3-2-4-9-20)25(33-21)26-19-7-5-6-18(15-19)23(29)30/h5-7,10-15,20H,2-4,8-9H2,1H3,(H,29,30)/b21-14-,26-25- |
| InChIKey | JQJVQQYDGVWBJV-ARDTVSTASA-N |
| XLogP | 5.11 |
| TPSA | 96.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.54 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|