C29H27ClN2O2S — CID 21206948
(5Z)-5-[[4-[(4-chlorophenyl)methoxy]phenyl]methylidene]-3-cyclohexyl-2-phenylimino-1,3-thiazolidin-4-one (PubChem CID 21206948) has the molecular formula C29H27ClN2O2S and a molecular weight of 503.07 g/mol. Its IUPAC name is (5Z)-5-[[4-[(4-chlorophenyl)methoxy]phenyl]methylidene]-3-cyclohexyl-2-phenylimino-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-5-[[4-[(4-chlorophenyl)methoxy]phenyl]methylidene]-3-cyclohexyl-2-phenylimino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 21206948 |
| Molecular Formula | C29H27ClN2O2S |
| Molecular Weight | 503.07 g/mol |
| Exact Mass | 502.15 |
| IUPAC Name | (5Z)-5-[[4-[(4-chlorophenyl)methoxy]phenyl]methylidene]-3-cyclohexyl-2-phenylimino-1,3-thiazolidin-4-one |
| SMILES | O=C1/C(=C/c2ccc(OCc3ccc(Cl)cc3)cc2)S/C(=N\c2ccccc2)N1C1CCCCC1 |
| InChI | InChI=1S/C29H27ClN2O2S/c30-23-15-11-22(12-16-23)20-34-26-17-13-21(14-18-26)19-27-28(33)32(25-9-5-2-6-10-25)29(35-27)31-24-7-3-1-4-8-24/h1,3-4,7-8,11-19,25H,2,5-6,9-10,20H2/b27-19-,31-29- |
| InChIKey | BNHPOJLYJMWDGL-BOTKPODPSA-N |
| XLogP | 7.86 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.07 |
| LogP ≤ 5 | 7.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|