C30H26ClN3O2S — CID 126148414
4-[[4-chloro-2-[(E)-(3-cyclohexyl-4-oxo-2-phenylimino-1,3-thiazolidin-5-ylidene)methyl]phenoxy]methyl]benzonitrile (PubChem CID 126148414) has the molecular formula C30H26ClN3O2S and a molecular weight of 528.08 g/mol. Its IUPAC name is 4-[[4-chloro-2-[(E)-(3-cyclohexyl-4-oxo-2-phenylimino-1,3-thiazolidin-5-ylidene)methyl]phenoxy]methyl]benzonitrile.
| Compound Name | 4-[[4-chloro-2-[(E)-(3-cyclohexyl-4-oxo-2-phenylimino-1,3-thiazolidin-5-ylidene)methyl]phenoxy]methyl]benzonitrile |
|---|---|
| PubChem CID | 126148414 |
| Molecular Formula | C30H26ClN3O2S |
| Molecular Weight | 528.08 g/mol |
| Exact Mass | 527.14 |
| IUPAC Name | 4-[[4-chloro-2-[(E)-(3-cyclohexyl-4-oxo-2-phenylimino-1,3-thiazolidin-5-ylidene)methyl]phenoxy]methyl]benzonitrile |
| SMILES | N#Cc1ccc(COc2ccc(Cl)cc2/C=C2/S/C(=N\c3ccccc3)N(C3CCCCC3)C2=O)cc1 |
| InChI | InChI=1S/C30H26ClN3O2S/c31-24-15-16-27(36-20-22-13-11-21(19-32)12-14-22)23(17-24)18-28-29(35)34(26-9-5-2-6-10-26)30(37-28)33-25-7-3-1-4-8-25/h1,3-4,7-8,11-18,26H,2,5-6,9-10,20H2/b28-18+,33-30- |
| InChIKey | RBFBQFYHJVJBLF-WMGVAAGXSA-N |
| XLogP | 7.73 |
| TPSA | 65.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.08 |
| LogP ≤ 5 | 7.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|