C23H23BrN2O3S — CID 3982627
5-[(5-bromo-2,4-dimethoxyphenyl)methylidene]-3-cyclopentyl-2-phenylimino-1,3-thiazolidin-4-one (PubChem CID 3982627) has the molecular formula C23H23BrN2O3S and a molecular weight of 487.42 g/mol. Its IUPAC name is 5-[(5-bromo-2,4-dimethoxyphenyl)methylidene]-3-cyclopentyl-2-phenylimino-1,3-thiazolidin-4-one.
| Compound Name | 5-[(5-bromo-2,4-dimethoxyphenyl)methylidene]-3-cyclopentyl-2-phenylimino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 3982627 |
| Molecular Formula | C23H23BrN2O3S |
| Molecular Weight | 487.42 g/mol |
| Exact Mass | 486.06 |
| IUPAC Name | 5-[(5-bromo-2,4-dimethoxyphenyl)methylidene]-3-cyclopentyl-2-phenylimino-1,3-thiazolidin-4-one |
| SMILES | COc1cc(OC)c(C=C2S/C(=N\c3ccccc3)N(C3CCCC3)C2=O)cc1Br |
| InChI | InChI=1S/C23H23BrN2O3S/c1-28-19-14-20(29-2)18(24)12-15(19)13-21-22(27)26(17-10-6-7-11-17)23(30-21)25-16-8-4-3-5-9-16/h3-5,8-9,12-14,17H,6-7,10-11H2,1-2H3/b21-13?,25-23- |
| InChIKey | ZHZCZUBIMJAPIJ-GZNAEEKOSA-N |
| XLogP | 6.01 |
| TPSA | 51.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.42 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|