C24H24BrFN2O3S — CID 3777351
5-[(5-bromo-2,4-dimethoxyphenyl)methylidene]-3-cyclohexyl-2-(2-fluorophenyl)imino-1,3-thiazolidin-4-one (PubChem CID 3777351) has the molecular formula C24H24BrFN2O3S and a molecular weight of 519.44 g/mol. Its IUPAC name is 5-[(5-bromo-2,4-dimethoxyphenyl)methylidene]-3-cyclohexyl-2-(2-fluorophenyl)imino-1,3-thiazolidin-4-one.
| Compound Name | 5-[(5-bromo-2,4-dimethoxyphenyl)methylidene]-3-cyclohexyl-2-(2-fluorophenyl)imino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 3777351 |
| Molecular Formula | C24H24BrFN2O3S |
| Molecular Weight | 519.44 g/mol |
| Exact Mass | 518.07 |
| IUPAC Name | 5-[(5-bromo-2,4-dimethoxyphenyl)methylidene]-3-cyclohexyl-2-(2-fluorophenyl)imino-1,3-thiazolidin-4-one |
| SMILES | COc1cc(OC)c(C=C2S/C(=N\c3ccccc3F)N(C3CCCCC3)C2=O)cc1Br |
| InChI | InChI=1S/C24H24BrFN2O3S/c1-30-20-14-21(31-2)17(25)12-15(20)13-22-23(29)28(16-8-4-3-5-9-16)24(32-22)27-19-11-7-6-10-18(19)26/h6-7,10-14,16H,3-5,8-9H2,1-2H3/b22-13?,27-24- |
| InChIKey | UXTAGVHTKWWVOK-LDDJVFITSA-N |
| XLogP | 6.54 |
| TPSA | 51.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.44 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|