C25H26FN3O4S — CID 56697499
2-[4-[(Z)-[3-cyclohexyl-2-(2-fluorophenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-2-methoxyphenoxy]acetamide (PubChem CID 56697499) has the molecular formula C25H26FN3O4S and a molecular weight of 483.57 g/mol. Its IUPAC name is 2-[4-[(Z)-[3-cyclohexyl-2-(2-fluorophenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-2-methoxyphenoxy]acetamide.
| Compound Name | 2-[4-[(Z)-[3-cyclohexyl-2-(2-fluorophenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-2-methoxyphenoxy]acetamide |
|---|---|
| PubChem CID | 56697499 |
| Molecular Formula | C25H26FN3O4S |
| Molecular Weight | 483.57 g/mol |
| Exact Mass | 483.16 |
| IUPAC Name | 2-[4-[(Z)-[3-cyclohexyl-2-(2-fluorophenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-2-methoxyphenoxy]acetamide |
| SMILES | COc1cc(/C=C2\S/C(=N\c3ccccc3F)N(C3CCCCC3)C2=O)ccc1OCC(N)=O |
| InChI | InChI=1S/C25H26FN3O4S/c1-32-21-13-16(11-12-20(21)33-15-23(27)30)14-22-24(31)29(17-7-3-2-4-8-17)25(34-22)28-19-10-6-5-9-18(19)26/h5-6,9-14,17H,2-4,7-8,15H2,1H3,(H2,27,30)/b22-14-,28-25- |
| InChIKey | AQMDQZAVQTWQQR-OUGGDVFGSA-N |
| XLogP | 4.64 |
| TPSA | 94.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.57 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|