C32H33N3O4S — CID 98619248
2-[2-methoxy-4-[(Z)-[3-[(1R,2S)-2-methylcyclohexyl]-4-oxo-2-phenylimino-1,3-thiazolidin-5-ylidene]methyl]phenoxy]-N-phenylacetamide (PubChem CID 98619248) has the molecular formula C32H33N3O4S and a molecular weight of 555.70 g/mol. Its IUPAC name is 2-[2-methoxy-4-[(Z)-[3-[(1R,2S)-2-methylcyclohexyl]-4-oxo-2-phenylimino-1,3-thiazolidin-5-ylidene]methyl]phenoxy]-N-phenylacetamide.
| Compound Name | 2-[2-methoxy-4-[(Z)-[3-[(1R,2S)-2-methylcyclohexyl]-4-oxo-2-phenylimino-1,3-thiazolidin-5-ylidene]methyl]phenoxy]-N-phenylacetamide |
|---|---|
| PubChem CID | 98619248 |
| Molecular Formula | C32H33N3O4S |
| Molecular Weight | 555.70 g/mol |
| Exact Mass | 555.22 |
| IUPAC Name | 2-[2-methoxy-4-[(Z)-[3-[(1R,2S)-2-methylcyclohexyl]-4-oxo-2-phenylimino-1,3-thiazolidin-5-ylidene]methyl]phenoxy]-N-phenylacetamide |
| SMILES | COc1cc(/C=C2\S/C(=N\c3ccccc3)N([C@@H]3CCCC[C@@H]3C)C2=O)ccc1OCC(=O)Nc1ccccc1 |
| InChI | InChI=1S/C32H33N3O4S/c1-22-11-9-10-16-26(22)35-31(37)29(40-32(35)34-25-14-7-4-8-15-25)20-23-17-18-27(28(19-23)38-2)39-21-30(36)33-24-12-5-3-6-13-24/h3-8,12-15,17-20,22,26H,9-11,16,21H2,1-2H3,(H,33,36)/b29-20-,34-32-/t22-,26+/m0/s1 |
| InChIKey | UXVVUCUUPBTNIX-MPWWADFVSA-N |
| XLogP | 6.90 |
| TPSA | 80.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.70 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|