C29H28ClN3O2S — CID 18843587
(5Z)-2-[(2-chloro-3-pyridinyl)imino]-3-cyclohexyl-5-[[2-[(4-methylphenyl)methoxy]phenyl]methylidene]-1,3-thiazolidin-4-one (PubChem CID 18843587) has the molecular formula C29H28ClN3O2S and a molecular weight of 518.08 g/mol. Its IUPAC name is (5Z)-2-[(2-chloro-3-pyridinyl)imino]-3-cyclohexyl-5-[[2-[(4-methylphenyl)methoxy]phenyl]methylidene]-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-2-[(2-chloro-3-pyridinyl)imino]-3-cyclohexyl-5-[[2-[(4-methylphenyl)methoxy]phenyl]methylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 18843587 |
| Molecular Formula | C29H28ClN3O2S |
| Molecular Weight | 518.08 g/mol |
| Exact Mass | 517.16 |
| IUPAC Name | (5Z)-2-[(2-chloro-3-pyridinyl)imino]-3-cyclohexyl-5-[[2-[(4-methylphenyl)methoxy]phenyl]methylidene]-1,3-thiazolidin-4-one |
| SMILES | Cc1ccc(COc2ccccc2/C=C2\S/C(=N\c3cccnc3Cl)N(C3CCCCC3)C2=O)cc1 |
| InChI | InChI=1S/C29H28ClN3O2S/c1-20-13-15-21(16-14-20)19-35-25-12-6-5-8-22(25)18-26-28(34)33(23-9-3-2-4-10-23)29(36-26)32-24-11-7-17-31-27(24)30/h5-8,11-18,23H,2-4,9-10,19H2,1H3/b26-18-,32-29- |
| InChIKey | GNRGACZVXAUAST-HNMAGBENSA-N |
| XLogP | 7.56 |
| TPSA | 54.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.08 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|