C23H25ClN4OS — CID 18843644
(5Z)-2-[(2-chloro-3-pyridinyl)imino]-3-cyclohexyl-5-[[4-(dimethylamino)phenyl]methylidene]-1,3-thiazolidin-4-one (PubChem CID 18843644) has the molecular formula C23H25ClN4OS and a molecular weight of 441.00 g/mol. Its IUPAC name is (5Z)-2-[(2-chloro-3-pyridinyl)imino]-3-cyclohexyl-5-[[4-(dimethylamino)phenyl]methylidene]-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-2-[(2-chloro-3-pyridinyl)imino]-3-cyclohexyl-5-[[4-(dimethylamino)phenyl]methylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 18843644 |
| Molecular Formula | C23H25ClN4OS |
| Molecular Weight | 441.00 g/mol |
| Exact Mass | 440.14 |
| IUPAC Name | (5Z)-2-[(2-chloro-3-pyridinyl)imino]-3-cyclohexyl-5-[[4-(dimethylamino)phenyl]methylidene]-1,3-thiazolidin-4-one |
| SMILES | CN(C)c1ccc(/C=C2\S/C(=N\c3cccnc3Cl)N(C3CCCCC3)C2=O)cc1 |
| InChI | InChI=1S/C23H25ClN4OS/c1-27(2)17-12-10-16(11-13-17)15-20-22(29)28(18-7-4-3-5-8-18)23(30-20)26-19-9-6-14-25-21(19)24/h6,9-15,18H,3-5,7-8H2,1-2H3/b20-15-,26-23- |
| InChIKey | ZYLXOQDIHRAKDB-DXDFYKGMSA-N |
| XLogP | 5.74 |
| TPSA | 48.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.00 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|