C25H21Cl2N3O2S — CID 18843599
(5E)-5-[[5-(2-chlorophenyl)furan-2-yl]methylidene]-2-[(2-chloro-3-pyridinyl)imino]-3-cyclohexyl-1,3-thiazolidin-4-one (PubChem CID 18843599) has the molecular formula C25H21Cl2N3O2S and a molecular weight of 498.44 g/mol. Its IUPAC name is (5E)-5-[[5-(2-chlorophenyl)furan-2-yl]methylidene]-2-[(2-chloro-3-pyridinyl)imino]-3-cyclohexyl-1,3-thiazolidin-4-one.
| Compound Name | (5E)-5-[[5-(2-chlorophenyl)furan-2-yl]methylidene]-2-[(2-chloro-3-pyridinyl)imino]-3-cyclohexyl-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 18843599 |
| Molecular Formula | C25H21Cl2N3O2S |
| Molecular Weight | 498.44 g/mol |
| Exact Mass | 497.07 |
| IUPAC Name | (5E)-5-[[5-(2-chlorophenyl)furan-2-yl]methylidene]-2-[(2-chloro-3-pyridinyl)imino]-3-cyclohexyl-1,3-thiazolidin-4-one |
| SMILES | O=C1/C(=C\c2ccc(-c3ccccc3Cl)o2)S/C(=N\c2cccnc2Cl)N1C1CCCCC1 |
| InChI | InChI=1S/C25H21Cl2N3O2S/c26-19-10-5-4-9-18(19)21-13-12-17(32-21)15-22-24(31)30(16-7-2-1-3-8-16)25(33-22)29-20-11-6-14-28-23(20)27/h4-6,9-16H,1-3,7-8H2/b22-15+,29-25- |
| InChIKey | CPEQABYXBQXCAT-JHSYLBHXSA-N |
| XLogP | 7.59 |
| TPSA | 58.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.44 |
| LogP ≤ 5 | 7.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|