C23H19Cl2N3O2S2 — CID 18844611
(2E,5E)-3-cyclohexyl-5-[[5-(2,5-dichlorophenyl)furan-2-yl]methylidene]-2-(1,3-thiazol-2-ylimino)-1,3-thiazolidin-4-one (PubChem CID 18844611) has the molecular formula C23H19Cl2N3O2S2 and a molecular weight of 504.46 g/mol. Its IUPAC name is (2E,5E)-3-cyclohexyl-5-[[5-(2,5-dichlorophenyl)furan-2-yl]methylidene]-2-(1,3-thiazol-2-ylimino)-1,3-thiazolidin-4-one.
| Compound Name | (2E,5E)-3-cyclohexyl-5-[[5-(2,5-dichlorophenyl)furan-2-yl]methylidene]-2-(1,3-thiazol-2-ylimino)-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 18844611 |
| Molecular Formula | C23H19Cl2N3O2S2 |
| Molecular Weight | 504.46 g/mol |
| Exact Mass | 503.03 |
| IUPAC Name | (2E,5E)-3-cyclohexyl-5-[[5-(2,5-dichlorophenyl)furan-2-yl]methylidene]-2-(1,3-thiazol-2-ylimino)-1,3-thiazolidin-4-one |
| SMILES | O=C1/C(=C\c2ccc(-c3cc(Cl)ccc3Cl)o2)S/C(=N/c2nccs2)N1C1CCCCC1 |
| InChI | InChI=1S/C23H19Cl2N3O2S2/c24-14-6-8-18(25)17(12-14)19-9-7-16(30-19)13-20-21(29)28(15-4-2-1-3-5-15)23(32-20)27-22-26-10-11-31-22/h6-13,15H,1-5H2/b20-13+,27-23+ |
| InChIKey | OVHLZLVCNPAUGF-KBTHYEKZSA-N |
| XLogP | 7.65 |
| TPSA | 58.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.46 |
| LogP ≤ 5 | 7.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|