C17H17N3O2S2 — CID 18844622
(2E,5E)-3-cyclohexyl-5-(furan-2-ylmethylidene)-2-(1,3-thiazol-2-ylimino)-1,3-thiazolidin-4-one (PubChem CID 18844622) has the molecular formula C17H17N3O2S2 and a molecular weight of 359.48 g/mol. Its IUPAC name is (2E,5E)-3-cyclohexyl-5-(furan-2-ylmethylidene)-2-(1,3-thiazol-2-ylimino)-1,3-thiazolidin-4-one.
| Compound Name | (2E,5E)-3-cyclohexyl-5-(furan-2-ylmethylidene)-2-(1,3-thiazol-2-ylimino)-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 18844622 |
| Molecular Formula | C17H17N3O2S2 |
| Molecular Weight | 359.48 g/mol |
| Exact Mass | 359.08 |
| IUPAC Name | (2E,5E)-3-cyclohexyl-5-(furan-2-ylmethylidene)-2-(1,3-thiazol-2-ylimino)-1,3-thiazolidin-4-one |
| SMILES | O=C1/C(=C\c2ccco2)S/C(=N/c2nccs2)N1C1CCCCC1 |
| InChI | InChI=1S/C17H17N3O2S2/c21-15-14(11-13-7-4-9-22-13)24-17(19-16-18-8-10-23-16)20(15)12-5-2-1-3-6-12/h4,7-12H,1-3,5-6H2/b14-11+,19-17+ |
| InChIKey | BEODXOKAEKHESH-YWUXTCLMSA-N |
| XLogP | 4.67 |
| TPSA | 58.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.48 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|