C20H20BrN3OS2 — CID 18845155
(2E,5Z)-5-[(3-bromophenyl)methylidene]-3-cyclohexyl-2-[(4-methyl-1,3-thiazol-2-yl)imino]-1,3-thiazolidin-4-one (PubChem CID 18845155) has the molecular formula C20H20BrN3OS2 and a molecular weight of 462.44 g/mol. Its IUPAC name is (2E,5Z)-5-[(3-bromophenyl)methylidene]-3-cyclohexyl-2-[(4-methyl-1,3-thiazol-2-yl)imino]-1,3-thiazolidin-4-one.
| Compound Name | (2E,5Z)-5-[(3-bromophenyl)methylidene]-3-cyclohexyl-2-[(4-methyl-1,3-thiazol-2-yl)imino]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 18845155 |
| Molecular Formula | C20H20BrN3OS2 |
| Molecular Weight | 462.44 g/mol |
| Exact Mass | 461.02 |
| IUPAC Name | (2E,5Z)-5-[(3-bromophenyl)methylidene]-3-cyclohexyl-2-[(4-methyl-1,3-thiazol-2-yl)imino]-1,3-thiazolidin-4-one |
| SMILES | Cc1csc(/N=C2/S/C(=C\c3cccc(Br)c3)C(=O)N2C2CCCCC2)n1 |
| InChI | InChI=1S/C20H20BrN3OS2/c1-13-12-26-19(22-13)23-20-24(16-8-3-2-4-9-16)18(25)17(27-20)11-14-6-5-7-15(21)10-14/h5-7,10-12,16H,2-4,8-9H2,1H3/b17-11-,23-20+ |
| InChIKey | PJEPZJGBHHIJSE-RVIYGNEXSA-N |
| XLogP | 6.15 |
| TPSA | 45.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.44 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|