C23H21N3O2S2 — CID 18845652
(2E,5E)-3-cyclohexyl-5-(furan-2-ylmethylidene)-2-[(4-phenyl-1,3-thiazol-2-yl)imino]-1,3-thiazolidin-4-one (PubChem CID 18845652) has the molecular formula C23H21N3O2S2 and a molecular weight of 435.57 g/mol. Its IUPAC name is (2E,5E)-3-cyclohexyl-5-(furan-2-ylmethylidene)-2-[(4-phenyl-1,3-thiazol-2-yl)imino]-1,3-thiazolidin-4-one.
| Compound Name | (2E,5E)-3-cyclohexyl-5-(furan-2-ylmethylidene)-2-[(4-phenyl-1,3-thiazol-2-yl)imino]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 18845652 |
| Molecular Formula | C23H21N3O2S2 |
| Molecular Weight | 435.57 g/mol |
| Exact Mass | 435.11 |
| IUPAC Name | (2E,5E)-3-cyclohexyl-5-(furan-2-ylmethylidene)-2-[(4-phenyl-1,3-thiazol-2-yl)imino]-1,3-thiazolidin-4-one |
| SMILES | O=C1/C(=C\c2ccco2)S/C(=N/c2nc(-c3ccccc3)cs2)N1C1CCCCC1 |
| InChI | InChI=1S/C23H21N3O2S2/c27-21-20(14-18-12-7-13-28-18)30-23(26(21)17-10-5-2-6-11-17)25-22-24-19(15-29-22)16-8-3-1-4-9-16/h1,3-4,7-9,12-15,17H,2,5-6,10-11H2/b20-14+,25-23+ |
| InChIKey | YOOWHYVBFVAEBC-YJECAWTJSA-N |
| XLogP | 6.34 |
| TPSA | 58.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.57 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|