C19H19N3O2S2 — CID 18844582
(2E,5Z)-3-cyclohexyl-5-[(2-hydroxyphenyl)methylidene]-2-(1,3-thiazol-2-ylimino)-1,3-thiazolidin-4-one (PubChem CID 18844582) has the molecular formula C19H19N3O2S2 and a molecular weight of 385.51 g/mol. Its IUPAC name is (2E,5Z)-3-cyclohexyl-5-[(2-hydroxyphenyl)methylidene]-2-(1,3-thiazol-2-ylimino)-1,3-thiazolidin-4-one.
| Compound Name | (2E,5Z)-3-cyclohexyl-5-[(2-hydroxyphenyl)methylidene]-2-(1,3-thiazol-2-ylimino)-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 18844582 |
| Molecular Formula | C19H19N3O2S2 |
| Molecular Weight | 385.51 g/mol |
| Exact Mass | 385.09 |
| IUPAC Name | (2E,5Z)-3-cyclohexyl-5-[(2-hydroxyphenyl)methylidene]-2-(1,3-thiazol-2-ylimino)-1,3-thiazolidin-4-one |
| SMILES | O=C1/C(=C/c2ccccc2O)S/C(=N/c2nccs2)N1C1CCCCC1 |
| InChI | InChI=1S/C19H19N3O2S2/c23-15-9-5-4-6-13(15)12-16-17(24)22(14-7-2-1-3-8-14)19(26-16)21-18-20-10-11-25-18/h4-6,9-12,14,23H,1-3,7-8H2/b16-12-,21-19+ |
| InChIKey | WFTYDDOFXGDIFA-ROLOMRMFSA-N |
| XLogP | 4.79 |
| TPSA | 65.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.51 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|