C20H20N4OS — CID 18842525
(2E,5Z)-3-cyclohexyl-2-pyridin-2-ylimino-5-(pyridin-4-ylmethylidene)-1,3-thiazolidin-4-one (PubChem CID 18842525) has the molecular formula C20H20N4OS and a molecular weight of 364.47 g/mol. Its IUPAC name is (2E,5Z)-3-cyclohexyl-2-pyridin-2-ylimino-5-(pyridin-4-ylmethylidene)-1,3-thiazolidin-4-one.
| Compound Name | (2E,5Z)-3-cyclohexyl-2-pyridin-2-ylimino-5-(pyridin-4-ylmethylidene)-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 18842525 |
| Molecular Formula | C20H20N4OS |
| Molecular Weight | 364.47 g/mol |
| Exact Mass | 364.14 |
| IUPAC Name | (2E,5Z)-3-cyclohexyl-2-pyridin-2-ylimino-5-(pyridin-4-ylmethylidene)-1,3-thiazolidin-4-one |
| SMILES | O=C1/C(=C/c2ccncc2)S/C(=N/c2ccccn2)N1C1CCCCC1 |
| InChI | InChI=1S/C20H20N4OS/c25-19-17(14-15-9-12-21-13-10-15)26-20(23-18-8-4-5-11-22-18)24(19)16-6-2-1-3-7-16/h4-5,8-14,16H,1-3,6-7H2/b17-14-,23-20+ |
| InChIKey | FQTJDYZLNJTOJC-RXMZMWHVSA-N |
| XLogP | 4.41 |
| TPSA | 58.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.47 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|