C26H24BrN3OS2 — CID 18845706
(2E,5Z)-5-[1-(4-bromophenyl)ethylidene]-3-cyclohexyl-2-[(4-phenyl-1,3-thiazol-2-yl)imino]-1,3-thiazolidin-4-one (PubChem CID 18845706) has the molecular formula C26H24BrN3OS2 and a molecular weight of 538.54 g/mol. Its IUPAC name is (2E,5Z)-5-[1-(4-bromophenyl)ethylidene]-3-cyclohexyl-2-[(4-phenyl-1,3-thiazol-2-yl)imino]-1,3-thiazolidin-4-one.
| Compound Name | (2E,5Z)-5-[1-(4-bromophenyl)ethylidene]-3-cyclohexyl-2-[(4-phenyl-1,3-thiazol-2-yl)imino]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 18845706 |
| Molecular Formula | C26H24BrN3OS2 |
| Molecular Weight | 538.54 g/mol |
| Exact Mass | 537.05 |
| IUPAC Name | (2E,5Z)-5-[1-(4-bromophenyl)ethylidene]-3-cyclohexyl-2-[(4-phenyl-1,3-thiazol-2-yl)imino]-1,3-thiazolidin-4-one |
| SMILES | C/C(=C1/S/C(=N/c2nc(-c3ccccc3)cs2)N(C2CCCCC2)C1=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C26H24BrN3OS2/c1-17(18-12-14-20(27)15-13-18)23-24(31)30(21-10-6-3-7-11-21)26(33-23)29-25-28-22(16-32-25)19-8-4-2-5-9-19/h2,4-5,8-9,12-16,21H,3,6-7,10-11H2,1H3/b23-17-,29-26+ |
| InChIKey | YICWENANTNXGJL-QLBFMJJISA-N |
| XLogP | 7.90 |
| TPSA | 45.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.54 |
| LogP ≤ 5 | 7.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|