C22H24N4OS — CID 18842637
(5Z)-5-[1-(4-aminophenyl)ethylidene]-3-cyclohexyl-2-pyridin-3-ylimino-1,3-thiazolidin-4-one (PubChem CID 18842637) has the molecular formula C22H24N4OS and a molecular weight of 392.53 g/mol. Its IUPAC name is (5Z)-5-[1-(4-aminophenyl)ethylidene]-3-cyclohexyl-2-pyridin-3-ylimino-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-5-[1-(4-aminophenyl)ethylidene]-3-cyclohexyl-2-pyridin-3-ylimino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 18842637 |
| Molecular Formula | C22H24N4OS |
| Molecular Weight | 392.53 g/mol |
| Exact Mass | 392.17 |
| IUPAC Name | (5Z)-5-[1-(4-aminophenyl)ethylidene]-3-cyclohexyl-2-pyridin-3-ylimino-1,3-thiazolidin-4-one |
| SMILES | C/C(=C1/S/C(=N\c2cccnc2)N(C2CCCCC2)C1=O)c1ccc(N)cc1 |
| InChI | InChI=1S/C22H24N4OS/c1-15(16-9-11-17(23)12-10-16)20-21(27)26(19-7-3-2-4-8-19)22(28-20)25-18-6-5-13-24-14-18/h5-6,9-14,19H,2-4,7-8,23H2,1H3/b20-15-,25-22- |
| InChIKey | XLALKMPRCAZVAS-YWNZOVFCSA-N |
| XLogP | 4.99 |
| TPSA | 71.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.53 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|