C28H26N2O4S — CID 126001559
3-[5-[(Z)-(3-cyclohexyl-4-oxo-2-phenylimino-1,3-thiazolidin-5-ylidene)methyl]furan-2-yl]-4-methylbenzoic acid (PubChem CID 126001559) has the molecular formula C28H26N2O4S and a molecular weight of 486.59 g/mol. Its IUPAC name is 3-[5-[(Z)-(3-cyclohexyl-4-oxo-2-phenylimino-1,3-thiazolidin-5-ylidene)methyl]furan-2-yl]-4-methylbenzoic acid.
| Compound Name | 3-[5-[(Z)-(3-cyclohexyl-4-oxo-2-phenylimino-1,3-thiazolidin-5-ylidene)methyl]furan-2-yl]-4-methylbenzoic acid |
|---|---|
| PubChem CID | 126001559 |
| Molecular Formula | C28H26N2O4S |
| Molecular Weight | 486.59 g/mol |
| Exact Mass | 486.16 |
| IUPAC Name | 3-[5-[(Z)-(3-cyclohexyl-4-oxo-2-phenylimino-1,3-thiazolidin-5-ylidene)methyl]furan-2-yl]-4-methylbenzoic acid |
| SMILES | Cc1ccc(C(=O)O)cc1-c1ccc(/C=C2\S/C(=N\c3ccccc3)N(C3CCCCC3)C2=O)o1 |
| InChI | InChI=1S/C28H26N2O4S/c1-18-12-13-19(27(32)33)16-23(18)24-15-14-22(34-24)17-25-26(31)30(21-10-6-3-7-11-21)28(35-25)29-20-8-4-2-5-9-20/h2,4-5,8-9,12-17,21H,3,6-7,10-11H2,1H3,(H,32,33)/b25-17-,29-28- |
| InChIKey | IBXBHFKCKBDVRT-HZPABMAHSA-N |
| XLogP | 6.89 |
| TPSA | 83.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.59 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_G(7)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|