C25H21NO5S — CID 126138825
3-[5-[(E)-[2,4-dioxo-3-(3-phenylpropyl)-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]-4-methylbenzoic acid (PubChem CID 126138825) has the molecular formula C25H21NO5S and a molecular weight of 447.51 g/mol. Its IUPAC name is 3-[5-[(E)-[2,4-dioxo-3-(3-phenylpropyl)-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]-4-methylbenzoic acid.
| Compound Name | 3-[5-[(E)-[2,4-dioxo-3-(3-phenylpropyl)-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]-4-methylbenzoic acid |
|---|---|
| PubChem CID | 126138825 |
| Molecular Formula | C25H21NO5S |
| Molecular Weight | 447.51 g/mol |
| Exact Mass | 447.11 |
| IUPAC Name | 3-[5-[(E)-[2,4-dioxo-3-(3-phenylpropyl)-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]-4-methylbenzoic acid |
| SMILES | Cc1ccc(C(=O)O)cc1-c1ccc(/C=C2/SC(=O)N(CCCc3ccccc3)C2=O)o1 |
| InChI | InChI=1S/C25H21NO5S/c1-16-9-10-18(24(28)29)14-20(16)21-12-11-19(31-21)15-22-23(27)26(25(30)32-22)13-5-8-17-6-3-2-4-7-17/h2-4,6-7,9-12,14-15H,5,8,13H2,1H3,(H,28,29)/b22-15+ |
| InChIKey | YKRHJVGCTMSBTH-PXLXIMEGSA-N |
| XLogP | 5.62 |
| TPSA | 87.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.51 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_G(7)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|