C22H21NO4S2 — CID 126333226
3-[5-[(E)-(3-cyclohexyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]furan-2-yl]-4-methylbenzoic acid (PubChem CID 126333226) has the molecular formula C22H21NO4S2 and a molecular weight of 427.55 g/mol. Its IUPAC name is 3-[5-[(E)-(3-cyclohexyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]furan-2-yl]-4-methylbenzoic acid.
| Compound Name | 3-[5-[(E)-(3-cyclohexyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]furan-2-yl]-4-methylbenzoic acid |
|---|---|
| PubChem CID | 126333226 |
| Molecular Formula | C22H21NO4S2 |
| Molecular Weight | 427.55 g/mol |
| Exact Mass | 427.09 |
| IUPAC Name | 3-[5-[(E)-(3-cyclohexyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]furan-2-yl]-4-methylbenzoic acid |
| SMILES | Cc1ccc(C(=O)O)cc1-c1ccc(/C=C2/SC(=S)N(C3CCCCC3)C2=O)o1 |
| InChI | InChI=1S/C22H21NO4S2/c1-13-7-8-14(21(25)26)11-17(13)18-10-9-16(27-18)12-19-20(24)23(22(28)29-19)15-5-3-2-4-6-15/h7-12,15H,2-6H2,1H3,(H,25,26)/b19-12+ |
| InChIKey | HQITXZIBQTWJQD-XDHOZWIPSA-N |
| XLogP | 5.49 |
| TPSA | 70.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.55 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'ene_rhod_G(7)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|