C29H29N3O4S — CID 126156441
(5E)-3-cyclohexyl-2-(4-ethylphenyl)imino-5-[[5-(2-methyl-3-nitrophenyl)furan-2-yl]methylidene]-1,3-thiazolidin-4-one (PubChem CID 126156441) has the molecular formula C29H29N3O4S and a molecular weight of 515.64 g/mol. Its IUPAC name is (5E)-3-cyclohexyl-2-(4-ethylphenyl)imino-5-[[5-(2-methyl-3-nitrophenyl)furan-2-yl]methylidene]-1,3-thiazolidin-4-one.
| Compound Name | (5E)-3-cyclohexyl-2-(4-ethylphenyl)imino-5-[[5-(2-methyl-3-nitrophenyl)furan-2-yl]methylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 126156441 |
| Molecular Formula | C29H29N3O4S |
| Molecular Weight | 515.64 g/mol |
| Exact Mass | 515.19 |
| IUPAC Name | (5E)-3-cyclohexyl-2-(4-ethylphenyl)imino-5-[[5-(2-methyl-3-nitrophenyl)furan-2-yl]methylidene]-1,3-thiazolidin-4-one |
| SMILES | CCc1ccc(/N=C2\S/C(=C/c3ccc(-c4cccc([N+](=O)[O-])c4C)o3)C(=O)N2C2CCCCC2)cc1 |
| InChI | InChI=1S/C29H29N3O4S/c1-3-20-12-14-21(15-13-20)30-29-31(22-8-5-4-6-9-22)28(33)27(37-29)18-23-16-17-26(36-23)24-10-7-11-25(19(24)2)32(34)35/h7,10-18,22H,3-6,8-9H2,1-2H3/b27-18+,30-29- |
| InChIKey | AOXTXOKNVOQFPC-DRSSFZSDSA-N |
| XLogP | 7.66 |
| TPSA | 88.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.64 |
| LogP ≤ 5 | 7.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|