C24H23N3O2S — CID 126124372
(5Z)-3-cyclohexyl-5-(1-methyl-2-oxoindol-3-ylidene)-2-phenylimino-1,3-thiazolidin-4-one (PubChem CID 126124372) has the molecular formula C24H23N3O2S and a molecular weight of 417.53 g/mol. Its IUPAC name is (5Z)-3-cyclohexyl-5-(1-methyl-2-oxoindol-3-ylidene)-2-phenylimino-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-3-cyclohexyl-5-(1-methyl-2-oxoindol-3-ylidene)-2-phenylimino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 126124372 |
| Molecular Formula | C24H23N3O2S |
| Molecular Weight | 417.53 g/mol |
| Exact Mass | 417.15 |
| IUPAC Name | (5Z)-3-cyclohexyl-5-(1-methyl-2-oxoindol-3-ylidene)-2-phenylimino-1,3-thiazolidin-4-one |
| SMILES | CN1C(=O)/C(=C2\S/C(=N\c3ccccc3)N(C3CCCCC3)C2=O)c2ccccc21 |
| InChI | InChI=1S/C24H23N3O2S/c1-26-19-15-9-8-14-18(19)20(22(26)28)21-23(29)27(17-12-6-3-7-13-17)24(30-21)25-16-10-4-2-5-11-16/h2,4-5,8-11,14-15,17H,3,6-7,12-13H2,1H3/b21-20-,25-24- |
| InChIKey | MVSNSAOKNCQKDH-GPIXMANTSA-N |
| XLogP | 4.97 |
| TPSA | 52.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.53 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|