C24H25N3O2S2 — CID 6148926
(5Z)-3-cyclohexyl-5-(3-ethyl-1,3-benzothiazol-2-ylidene)-2-(4-hydroxyphenyl)imino-1,3-thiazolidin-4-one (PubChem CID 6148926) has the molecular formula C24H25N3O2S2 and a molecular weight of 451.62 g/mol. Its IUPAC name is (5Z)-3-cyclohexyl-5-(3-ethyl-1,3-benzothiazol-2-ylidene)-2-(4-hydroxyphenyl)imino-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-3-cyclohexyl-5-(3-ethyl-1,3-benzothiazol-2-ylidene)-2-(4-hydroxyphenyl)imino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 6148926 |
| Molecular Formula | C24H25N3O2S2 |
| Molecular Weight | 451.62 g/mol |
| Exact Mass | 451.14 |
| IUPAC Name | (5Z)-3-cyclohexyl-5-(3-ethyl-1,3-benzothiazol-2-ylidene)-2-(4-hydroxyphenyl)imino-1,3-thiazolidin-4-one |
| SMILES | CCN1/C(=C2/S/C(=N\c3ccc(O)cc3)N(C3CCCCC3)C2=O)Sc2ccccc21 |
| InChI | InChI=1S/C24H25N3O2S2/c1-2-26-19-10-6-7-11-20(19)30-23(26)21-22(29)27(17-8-4-3-5-9-17)24(31-21)25-16-12-14-18(28)15-13-16/h6-7,10-15,17,28H,2-5,8-9H2,1H3/b23-21-,25-24- |
| InChIKey | XGNWENKIWGBEDI-QDJRPKQISA-N |
| XLogP | 6.09 |
| TPSA | 56.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.62 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|