C25H23ClF3N3OS2 — CID 5127928
5-(5-chloro-3-ethyl-1,3-benzothiazol-2-ylidene)-3-cyclohexyl-2-[3-(trifluoromethyl)phenyl]imino-1,3-thiazolidin-4-one (PubChem CID 5127928) has the molecular formula C25H23ClF3N3OS2 and a molecular weight of 538.06 g/mol. Its IUPAC name is 5-(5-chloro-3-ethyl-1,3-benzothiazol-2-ylidene)-3-cyclohexyl-2-[3-(trifluoromethyl)phenyl]imino-1,3-thiazolidin-4-one.
| Compound Name | 5-(5-chloro-3-ethyl-1,3-benzothiazol-2-ylidene)-3-cyclohexyl-2-[3-(trifluoromethyl)phenyl]imino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 5127928 |
| Molecular Formula | C25H23ClF3N3OS2 |
| Molecular Weight | 538.06 g/mol |
| Exact Mass | 537.09 |
| IUPAC Name | 5-(5-chloro-3-ethyl-1,3-benzothiazol-2-ylidene)-3-cyclohexyl-2-[3-(trifluoromethyl)phenyl]imino-1,3-thiazolidin-4-one |
| SMILES | CCN1C(=C2S/C(=N\c3cccc(C(F)(F)F)c3)N(C3CCCCC3)C2=O)Sc2ccc(Cl)cc21 |
| InChI | InChI=1S/C25H23ClF3N3OS2/c1-2-31-19-14-16(26)11-12-20(19)34-23(31)21-22(33)32(18-9-4-3-5-10-18)24(35-21)30-17-8-6-7-15(13-17)25(27,28)29/h6-8,11-14,18H,2-5,9-10H2,1H3/b23-21?,30-24- |
| InChIKey | GDWWDNICOVHGSP-CBKDQVEYSA-N |
| XLogP | 8.06 |
| TPSA | 35.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.06 |
| LogP ≤ 5 | 8.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|