C30H38N4O2S2 — CID 3727185
3-cyclohexyl-2-[4-(diethylamino)-2-methylphenyl]imino-5-(3-ethyl-5-methoxy-1,3-benzothiazol-2-ylidene)-1,3-thiazolidin-4-one (PubChem CID 3727185) has the molecular formula C30H38N4O2S2 and a molecular weight of 550.79 g/mol. Its IUPAC name is 3-cyclohexyl-2-[4-(diethylamino)-2-methylphenyl]imino-5-(3-ethyl-5-methoxy-1,3-benzothiazol-2-ylidene)-1,3-thiazolidin-4-one.
| Compound Name | 3-cyclohexyl-2-[4-(diethylamino)-2-methylphenyl]imino-5-(3-ethyl-5-methoxy-1,3-benzothiazol-2-ylidene)-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 3727185 |
| Molecular Formula | C30H38N4O2S2 |
| Molecular Weight | 550.79 g/mol |
| Exact Mass | 550.24 |
| IUPAC Name | 3-cyclohexyl-2-[4-(diethylamino)-2-methylphenyl]imino-5-(3-ethyl-5-methoxy-1,3-benzothiazol-2-ylidene)-1,3-thiazolidin-4-one |
| SMILES | CCN(CC)c1ccc(/N=C2\SC(=C3Sc4ccc(OC)cc4N3CC)C(=O)N2C2CCCCC2)c(C)c1 |
| InChI | InChI=1S/C30H38N4O2S2/c1-6-32(7-2)22-14-16-24(20(4)18-22)31-30-34(21-12-10-9-11-13-21)28(35)27(38-30)29-33(8-3)25-19-23(36-5)15-17-26(25)37-29/h14-19,21H,6-13H2,1-5H3/b29-27?,31-30- |
| InChIKey | CEAGTYXFJITGCY-VZYGRBMASA-N |
| XLogP | 7.55 |
| TPSA | 48.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.79 |
| LogP ≤ 5 | 7.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|