C26H29N3O2S2 — CID 4538104
3-cyclohexyl-2-(3,4-dimethylphenyl)imino-5-(5-methoxy-3-methyl-1,3-benzothiazol-2-ylidene)-1,3-thiazolidin-4-one (PubChem CID 4538104) has the molecular formula C26H29N3O2S2 and a molecular weight of 479.67 g/mol. Its IUPAC name is 3-cyclohexyl-2-(3,4-dimethylphenyl)imino-5-(5-methoxy-3-methyl-1,3-benzothiazol-2-ylidene)-1,3-thiazolidin-4-one.
| Compound Name | 3-cyclohexyl-2-(3,4-dimethylphenyl)imino-5-(5-methoxy-3-methyl-1,3-benzothiazol-2-ylidene)-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 4538104 |
| Molecular Formula | C26H29N3O2S2 |
| Molecular Weight | 479.67 g/mol |
| Exact Mass | 479.17 |
| IUPAC Name | 3-cyclohexyl-2-(3,4-dimethylphenyl)imino-5-(5-methoxy-3-methyl-1,3-benzothiazol-2-ylidene)-1,3-thiazolidin-4-one |
| SMILES | COc1ccc2c(c1)N(C)C(=C1S/C(=N\c3ccc(C)c(C)c3)N(C3CCCCC3)C1=O)S2 |
| InChI | InChI=1S/C26H29N3O2S2/c1-16-10-11-18(14-17(16)2)27-26-29(19-8-6-5-7-9-19)24(30)23(33-26)25-28(3)21-15-20(31-4)12-13-22(21)32-25/h10-15,19H,5-9H2,1-4H3/b25-23?,27-26- |
| InChIKey | RAMQGRGGDZHGMV-ZUAQKOPXSA-N |
| XLogP | 6.62 |
| TPSA | 45.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.67 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|