C21H17Cl2N3O2S2 — CID 3727609
2-(3,4-dichlorophenyl)imino-5-(5-methoxy-3-methyl-1,3-benzothiazol-2-ylidene)-3-prop-2-enyl-1,3-thiazolidin-4-one (PubChem CID 3727609) has the molecular formula C21H17Cl2N3O2S2 and a molecular weight of 478.43 g/mol. Its IUPAC name is 2-(3,4-dichlorophenyl)imino-5-(5-methoxy-3-methyl-1,3-benzothiazol-2-ylidene)-3-prop-2-enyl-1,3-thiazolidin-4-one.
| Compound Name | 2-(3,4-dichlorophenyl)imino-5-(5-methoxy-3-methyl-1,3-benzothiazol-2-ylidene)-3-prop-2-enyl-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 3727609 |
| Molecular Formula | C21H17Cl2N3O2S2 |
| Molecular Weight | 478.43 g/mol |
| Exact Mass | 477.01 |
| IUPAC Name | 2-(3,4-dichlorophenyl)imino-5-(5-methoxy-3-methyl-1,3-benzothiazol-2-ylidene)-3-prop-2-enyl-1,3-thiazolidin-4-one |
| SMILES | C=CCN1C(=O)C(=C2Sc3ccc(OC)cc3N2C)S/C1=N\c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C21H17Cl2N3O2S2/c1-4-9-26-19(27)18(30-21(26)24-12-5-7-14(22)15(23)10-12)20-25(2)16-11-13(28-3)6-8-17(16)29-20/h4-8,10-11H,1,9H2,2-3H3/b20-18?,24-21- |
| InChIKey | NBAFUGPIOUWLPB-VKNMOEGYSA-N |
| XLogP | 6.16 |
| TPSA | 45.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.43 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|