C33H27N3O2S2 — CID 3254037
3-benzyl-5-(5-methoxy-3-methyl-1,3-benzothiazol-2-ylidene)-2-[4-(2-phenylethenyl)phenyl]imino-1,3-thiazolidin-4-one (PubChem CID 3254037) has the molecular formula C33H27N3O2S2 and a molecular weight of 561.73 g/mol. Its IUPAC name is 3-benzyl-5-(5-methoxy-3-methyl-1,3-benzothiazol-2-ylidene)-2-[4-(2-phenylethenyl)phenyl]imino-1,3-thiazolidin-4-one.
| Compound Name | 3-benzyl-5-(5-methoxy-3-methyl-1,3-benzothiazol-2-ylidene)-2-[4-(2-phenylethenyl)phenyl]imino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 3254037 |
| Molecular Formula | C33H27N3O2S2 |
| Molecular Weight | 561.73 g/mol |
| Exact Mass | 561.15 |
| IUPAC Name | 3-benzyl-5-(5-methoxy-3-methyl-1,3-benzothiazol-2-ylidene)-2-[4-(2-phenylethenyl)phenyl]imino-1,3-thiazolidin-4-one |
| SMILES | COc1ccc2c(c1)N(C)C(=C1S/C(=N\c3ccc(C=Cc4ccccc4)cc3)N(Cc3ccccc3)C1=O)S2 |
| InChI | InChI=1S/C33H27N3O2S2/c1-35-28-21-27(38-2)19-20-29(28)39-32(35)30-31(37)36(22-25-11-7-4-8-12-25)33(40-30)34-26-17-15-24(16-18-26)14-13-23-9-5-3-6-10-23/h3-21H,22H2,1-2H3/b14-13?,32-30?,34-33- |
| InChIKey | JAEICQBCOWZQCQ-ZDOXFPAISA-N |
| XLogP | 8.04 |
| TPSA | 45.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.73 |
| LogP ≤ 5 | 8.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|