C28H25N3O3S2 — CID 5143089
2-(4-acetylphenyl)imino-5-(5-methoxy-3-methyl-1,3-benzothiazol-2-ylidene)-3-(2-phenylethyl)-1,3-thiazolidin-4-one (PubChem CID 5143089) has the molecular formula C28H25N3O3S2 and a molecular weight of 515.66 g/mol. Its IUPAC name is 2-(4-acetylphenyl)imino-5-(5-methoxy-3-methyl-1,3-benzothiazol-2-ylidene)-3-(2-phenylethyl)-1,3-thiazolidin-4-one.
| Compound Name | 2-(4-acetylphenyl)imino-5-(5-methoxy-3-methyl-1,3-benzothiazol-2-ylidene)-3-(2-phenylethyl)-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 5143089 |
| Molecular Formula | C28H25N3O3S2 |
| Molecular Weight | 515.66 g/mol |
| Exact Mass | 515.13 |
| IUPAC Name | 2-(4-acetylphenyl)imino-5-(5-methoxy-3-methyl-1,3-benzothiazol-2-ylidene)-3-(2-phenylethyl)-1,3-thiazolidin-4-one |
| SMILES | COc1ccc2c(c1)N(C)C(=C1S/C(=N\c3ccc(C(C)=O)cc3)N(CCc3ccccc3)C1=O)S2 |
| InChI | InChI=1S/C28H25N3O3S2/c1-18(32)20-9-11-21(12-10-20)29-28-31(16-15-19-7-5-4-6-8-19)26(33)25(36-28)27-30(2)23-17-22(34-3)13-14-24(23)35-27/h4-14,17H,15-16H2,1-3H3/b27-25?,29-28- |
| InChIKey | RQPMNJAOBYNOMU-FCYFMNRGSA-N |
| XLogP | 6.11 |
| TPSA | 62.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.66 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|