C26H23N3O2S2 — CID 6128771
(5Z)-3-benzyl-5-(5-methoxy-3-methyl-1,3-benzothiazol-2-ylidene)-2-(4-methylphenyl)imino-1,3-thiazolidin-4-one (PubChem CID 6128771) has the molecular formula C26H23N3O2S2 and a molecular weight of 473.62 g/mol. Its IUPAC name is (5Z)-3-benzyl-5-(5-methoxy-3-methyl-1,3-benzothiazol-2-ylidene)-2-(4-methylphenyl)imino-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-3-benzyl-5-(5-methoxy-3-methyl-1,3-benzothiazol-2-ylidene)-2-(4-methylphenyl)imino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 6128771 |
| Molecular Formula | C26H23N3O2S2 |
| Molecular Weight | 473.62 g/mol |
| Exact Mass | 473.12 |
| IUPAC Name | (5Z)-3-benzyl-5-(5-methoxy-3-methyl-1,3-benzothiazol-2-ylidene)-2-(4-methylphenyl)imino-1,3-thiazolidin-4-one |
| SMILES | COc1ccc2c(c1)N(C)/C(=C1/S/C(=N\c3ccc(C)cc3)N(Cc3ccccc3)C1=O)S2 |
| InChI | InChI=1S/C26H23N3O2S2/c1-17-9-11-19(12-10-17)27-26-29(16-18-7-5-4-6-8-18)24(30)23(33-26)25-28(2)21-15-20(31-3)13-14-22(21)32-25/h4-15H,16H2,1-3H3/b25-23-,27-26- |
| InChIKey | XDHMHZXQZKKDKS-SCMILFJUSA-N |
| XLogP | 6.18 |
| TPSA | 45.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.62 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|