C26H23N3O3S2 — CID 6128769
(5Z)-3-benzyl-5-(5-methoxy-3-methyl-1,3-benzothiazol-2-ylidene)-2-(4-methoxyphenyl)imino-1,3-thiazolidin-4-one (PubChem CID 6128769) has the molecular formula C26H23N3O3S2 and a molecular weight of 489.62 g/mol. Its IUPAC name is (5Z)-3-benzyl-5-(5-methoxy-3-methyl-1,3-benzothiazol-2-ylidene)-2-(4-methoxyphenyl)imino-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-3-benzyl-5-(5-methoxy-3-methyl-1,3-benzothiazol-2-ylidene)-2-(4-methoxyphenyl)imino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 6128769 |
| Molecular Formula | C26H23N3O3S2 |
| Molecular Weight | 489.62 g/mol |
| Exact Mass | 489.12 |
| IUPAC Name | (5Z)-3-benzyl-5-(5-methoxy-3-methyl-1,3-benzothiazol-2-ylidene)-2-(4-methoxyphenyl)imino-1,3-thiazolidin-4-one |
| SMILES | COc1ccc(/N=C2\S/C(=C3\Sc4ccc(OC)cc4N3C)C(=O)N2Cc2ccccc2)cc1 |
| InChI | InChI=1S/C26H23N3O3S2/c1-28-21-15-20(32-3)13-14-22(21)33-25(28)23-24(30)29(16-17-7-5-4-6-8-17)26(34-23)27-18-9-11-19(31-2)12-10-18/h4-15H,16H2,1-3H3/b25-23-,27-26- |
| InChIKey | GJFSRMSEKOULSW-SCMILFJUSA-N |
| XLogP | 5.88 |
| TPSA | 54.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.62 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|