C27H23N3O4S2 — CID 3681627
3-benzyl-2-(2,3-dihydro-1,4-benzodioxin-6-ylimino)-5-(5-methoxy-3-methyl-1,3-benzothiazol-2-ylidene)-1,3-thiazolidin-4-one (PubChem CID 3681627) has the molecular formula C27H23N3O4S2 and a molecular weight of 517.63 g/mol. Its IUPAC name is 3-benzyl-2-(2,3-dihydro-1,4-benzodioxin-6-ylimino)-5-(5-methoxy-3-methyl-1,3-benzothiazol-2-ylidene)-1,3-thiazolidin-4-one.
| Compound Name | 3-benzyl-2-(2,3-dihydro-1,4-benzodioxin-6-ylimino)-5-(5-methoxy-3-methyl-1,3-benzothiazol-2-ylidene)-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 3681627 |
| Molecular Formula | C27H23N3O4S2 |
| Molecular Weight | 517.63 g/mol |
| Exact Mass | 517.11 |
| IUPAC Name | 3-benzyl-2-(2,3-dihydro-1,4-benzodioxin-6-ylimino)-5-(5-methoxy-3-methyl-1,3-benzothiazol-2-ylidene)-1,3-thiazolidin-4-one |
| SMILES | COc1ccc2c(c1)N(C)C(=C1S/C(=N/c3ccc4c(c3)OCCO4)N(Cc3ccccc3)C1=O)S2 |
| InChI | InChI=1S/C27H23N3O4S2/c1-29-20-15-19(32-2)9-11-23(20)35-26(29)24-25(31)30(16-17-6-4-3-5-7-17)27(36-24)28-18-8-10-21-22(14-18)34-13-12-33-21/h3-11,14-15H,12-13,16H2,1-2H3/b26-24?,28-27+ |
| InChIKey | GLGBOAYRWZDTOF-URIUOYEXSA-N |
| XLogP | 5.64 |
| TPSA | 63.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.63 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|