C20H19N3O2S2 — CID 3453739
3-ethyl-2-(4-methoxyphenyl)imino-5-(3-methyl-1,3-benzothiazol-2-ylidene)-1,3-thiazolidin-4-one (PubChem CID 3453739) has the molecular formula C20H19N3O2S2 and a molecular weight of 397.53 g/mol. Its IUPAC name is 3-ethyl-2-(4-methoxyphenyl)imino-5-(3-methyl-1,3-benzothiazol-2-ylidene)-1,3-thiazolidin-4-one.
| Compound Name | 3-ethyl-2-(4-methoxyphenyl)imino-5-(3-methyl-1,3-benzothiazol-2-ylidene)-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 3453739 |
| Molecular Formula | C20H19N3O2S2 |
| Molecular Weight | 397.53 g/mol |
| Exact Mass | 397.09 |
| IUPAC Name | 3-ethyl-2-(4-methoxyphenyl)imino-5-(3-methyl-1,3-benzothiazol-2-ylidene)-1,3-thiazolidin-4-one |
| SMILES | CCN1C(=O)C(=C2Sc3ccccc3N2C)S/C1=N\c1ccc(OC)cc1 |
| InChI | InChI=1S/C20H19N3O2S2/c1-4-23-18(24)17(19-22(2)15-7-5-6-8-16(15)26-19)27-20(23)21-13-9-11-14(25-3)12-10-13/h5-12H,4H2,1-3H3/b19-17?,21-20- |
| InChIKey | YQJYKJUZXUKQEQ-SAIDMTFYSA-N |
| XLogP | 4.69 |
| TPSA | 45.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.53 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|