C25H19N3O3S2 — CID 87374375
4-[[3-benzyl-5-(3-methyl-1,3-benzothiazol-2-ylidene)-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoic acid (PubChem CID 87374375) has the molecular formula C25H19N3O3S2 and a molecular weight of 473.58 g/mol. Its IUPAC name is 4-[[3-benzyl-5-(3-methyl-1,3-benzothiazol-2-ylidene)-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoic acid.
| Compound Name | 4-[[3-benzyl-5-(3-methyl-1,3-benzothiazol-2-ylidene)-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoic acid |
|---|---|
| PubChem CID | 87374375 |
| Molecular Formula | C25H19N3O3S2 |
| Molecular Weight | 473.58 g/mol |
| Exact Mass | 473.09 |
| IUPAC Name | 4-[[3-benzyl-5-(3-methyl-1,3-benzothiazol-2-ylidene)-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoic acid |
| SMILES | CN1C(=C2S/C(=N\c3ccc(C(=O)O)cc3)N(Cc3ccccc3)C2=O)Sc2ccccc21 |
| InChI | InChI=1S/C25H19N3O3S2/c1-27-19-9-5-6-10-20(19)32-23(27)21-22(29)28(15-16-7-3-2-4-8-16)25(33-21)26-18-13-11-17(12-14-18)24(30)31/h2-14H,15H2,1H3,(H,30,31)/b23-21?,26-25- |
| InChIKey | HVXUDOBOWHDPNV-UFMKNIBESA-N |
| XLogP | 5.56 |
| TPSA | 73.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.58 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|