C19H16ClN3OS2 — CID 5100154
2-(3-chlorophenyl)imino-3-ethyl-5-(3-methyl-1,3-benzothiazol-2-ylidene)-1,3-thiazolidin-4-one (PubChem CID 5100154) has the molecular formula C19H16ClN3OS2 and a molecular weight of 401.94 g/mol. Its IUPAC name is 2-(3-chlorophenyl)imino-3-ethyl-5-(3-methyl-1,3-benzothiazol-2-ylidene)-1,3-thiazolidin-4-one.
| Compound Name | 2-(3-chlorophenyl)imino-3-ethyl-5-(3-methyl-1,3-benzothiazol-2-ylidene)-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 5100154 |
| Molecular Formula | C19H16ClN3OS2 |
| Molecular Weight | 401.94 g/mol |
| Exact Mass | 401.04 |
| IUPAC Name | 2-(3-chlorophenyl)imino-3-ethyl-5-(3-methyl-1,3-benzothiazol-2-ylidene)-1,3-thiazolidin-4-one |
| SMILES | CCN1C(=O)C(=C2Sc3ccccc3N2C)S/C1=N\c1cccc(Cl)c1 |
| InChI | InChI=1S/C19H16ClN3OS2/c1-3-23-17(24)16(18-22(2)14-9-4-5-10-15(14)25-18)26-19(23)21-13-8-6-7-12(20)11-13/h4-11H,3H2,1-2H3/b18-16?,21-19- |
| InChIKey | DSNDJPSLXQUPOJ-ZJUUXLFTSA-N |
| XLogP | 5.33 |
| TPSA | 35.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.94 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|