C21H18N4OS3 — CID 3093951
(5Z)-3-ethyl-5-(3-methyl-1,3-benzothiazol-2-ylidene)-2-[(2-methyl-1,3-benzothiazol-5-yl)imino]-1,3-thiazolidin-4-one (PubChem CID 3093951) has the molecular formula C21H18N4OS3 and a molecular weight of 438.60 g/mol. Its IUPAC name is (5Z)-3-ethyl-5-(3-methyl-1,3-benzothiazol-2-ylidene)-2-[(2-methyl-1,3-benzothiazol-5-yl)imino]-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-3-ethyl-5-(3-methyl-1,3-benzothiazol-2-ylidene)-2-[(2-methyl-1,3-benzothiazol-5-yl)imino]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 3093951 |
| Molecular Formula | C21H18N4OS3 |
| Molecular Weight | 438.60 g/mol |
| Exact Mass | 438.06 |
| IUPAC Name | (5Z)-3-ethyl-5-(3-methyl-1,3-benzothiazol-2-ylidene)-2-[(2-methyl-1,3-benzothiazol-5-yl)imino]-1,3-thiazolidin-4-one |
| SMILES | CCN1C(=O)/C(=C2/Sc3ccccc3N2C)S/C1=N\c1ccc2sc(C)nc2c1 |
| InChI | InChI=1S/C21H18N4OS3/c1-4-25-19(26)18(20-24(3)15-7-5-6-8-17(15)28-20)29-21(25)23-13-9-10-16-14(11-13)22-12(2)27-16/h5-11H,4H2,1-3H3/b20-18-,23-21- |
| InChIKey | WBICKEASKIFVFD-QUOYTPRUSA-N |
| XLogP | 5.60 |
| TPSA | 48.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.60 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|