C27H22N4OS3 — CID 6181070
(5Z)-3-benzyl-5-(3-ethyl-1,3-benzothiazol-2-ylidene)-2-[(2-methyl-1,3-benzothiazol-5-yl)imino]-1,3-thiazolidin-4-one (PubChem CID 6181070) has the molecular formula C27H22N4OS3 and a molecular weight of 514.70 g/mol. Its IUPAC name is (5Z)-3-benzyl-5-(3-ethyl-1,3-benzothiazol-2-ylidene)-2-[(2-methyl-1,3-benzothiazol-5-yl)imino]-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-3-benzyl-5-(3-ethyl-1,3-benzothiazol-2-ylidene)-2-[(2-methyl-1,3-benzothiazol-5-yl)imino]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 6181070 |
| Molecular Formula | C27H22N4OS3 |
| Molecular Weight | 514.70 g/mol |
| Exact Mass | 514.10 |
| IUPAC Name | (5Z)-3-benzyl-5-(3-ethyl-1,3-benzothiazol-2-ylidene)-2-[(2-methyl-1,3-benzothiazol-5-yl)imino]-1,3-thiazolidin-4-one |
| SMILES | CCN1/C(=C2/S/C(=N\c3ccc4sc(C)nc4c3)N(Cc3ccccc3)C2=O)Sc2ccccc21 |
| InChI | InChI=1S/C27H22N4OS3/c1-3-30-21-11-7-8-12-23(21)34-26(30)24-25(32)31(16-18-9-5-4-6-10-18)27(35-24)29-19-13-14-22-20(15-19)28-17(2)33-22/h4-15H,3,16H2,1-2H3/b26-24-,29-27- |
| InChIKey | IZQRYOVXHIFBSG-NPGLLJSBSA-N |
| XLogP | 7.17 |
| TPSA | 48.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.70 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|