C25H21N3OS2 — CID 3093996
(5Z)-5-(3-ethyl-1,3-benzothiazol-2-ylidene)-2-naphthalen-2-ylimino-3-prop-2-enyl-1,3-thiazolidin-4-one (PubChem CID 3093996) has the molecular formula C25H21N3OS2 and a molecular weight of 443.60 g/mol. Its IUPAC name is (5Z)-5-(3-ethyl-1,3-benzothiazol-2-ylidene)-2-naphthalen-2-ylimino-3-prop-2-enyl-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-5-(3-ethyl-1,3-benzothiazol-2-ylidene)-2-naphthalen-2-ylimino-3-prop-2-enyl-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 3093996 |
| Molecular Formula | C25H21N3OS2 |
| Molecular Weight | 443.60 g/mol |
| Exact Mass | 443.11 |
| IUPAC Name | (5Z)-5-(3-ethyl-1,3-benzothiazol-2-ylidene)-2-naphthalen-2-ylimino-3-prop-2-enyl-1,3-thiazolidin-4-one |
| SMILES | C=CCN1C(=O)/C(=C2/Sc3ccccc3N2CC)S/C1=N\c1ccc2ccccc2c1 |
| InChI | InChI=1S/C25H21N3OS2/c1-3-15-28-23(29)22(24-27(4-2)20-11-7-8-12-21(20)30-24)31-25(28)26-19-14-13-17-9-5-6-10-18(17)16-19/h3,5-14,16H,1,4,15H2,2H3/b24-22-,26-25- |
| InChIKey | BOAKFOHGWYGPSQ-SLJQUXCSSA-N |
| XLogP | 6.39 |
| TPSA | 35.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.60 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|