C24H20N4OS2 — CID 3719969
5-(3-ethyl-1,3-benzothiazol-2-ylidene)-3-prop-2-enyl-2-quinolin-5-ylimino-1,3-thiazolidin-4-one (PubChem CID 3719969) has the molecular formula C24H20N4OS2 and a molecular weight of 444.59 g/mol. Its IUPAC name is 5-(3-ethyl-1,3-benzothiazol-2-ylidene)-3-prop-2-enyl-2-quinolin-5-ylimino-1,3-thiazolidin-4-one.
| Compound Name | 5-(3-ethyl-1,3-benzothiazol-2-ylidene)-3-prop-2-enyl-2-quinolin-5-ylimino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 3719969 |
| Molecular Formula | C24H20N4OS2 |
| Molecular Weight | 444.59 g/mol |
| Exact Mass | 444.11 |
| IUPAC Name | 5-(3-ethyl-1,3-benzothiazol-2-ylidene)-3-prop-2-enyl-2-quinolin-5-ylimino-1,3-thiazolidin-4-one |
| SMILES | C=CCN1C(=O)C(=C2Sc3ccccc3N2CC)S/C1=N/c1cccc2ncccc12 |
| InChI | InChI=1S/C24H20N4OS2/c1-3-15-28-22(29)21(23-27(4-2)19-12-5-6-13-20(19)30-23)31-24(28)26-18-11-7-10-17-16(18)9-8-14-25-17/h3,5-14H,1,4,15H2,2H3/b23-21?,26-24+ |
| InChIKey | POVZPZQTLHCKRU-RAYJIRAGSA-N |
| XLogP | 5.78 |
| TPSA | 48.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.59 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|