C24H20N4O2S2 — CID 3843655
5-(5-methoxy-3-methyl-1,3-benzothiazol-2-ylidene)-3-prop-2-enyl-2-quinolin-5-ylimino-1,3-thiazolidin-4-one (PubChem CID 3843655) has the molecular formula C24H20N4O2S2 and a molecular weight of 460.58 g/mol. Its IUPAC name is 5-(5-methoxy-3-methyl-1,3-benzothiazol-2-ylidene)-3-prop-2-enyl-2-quinolin-5-ylimino-1,3-thiazolidin-4-one.
| Compound Name | 5-(5-methoxy-3-methyl-1,3-benzothiazol-2-ylidene)-3-prop-2-enyl-2-quinolin-5-ylimino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 3843655 |
| Molecular Formula | C24H20N4O2S2 |
| Molecular Weight | 460.58 g/mol |
| Exact Mass | 460.10 |
| IUPAC Name | 5-(5-methoxy-3-methyl-1,3-benzothiazol-2-ylidene)-3-prop-2-enyl-2-quinolin-5-ylimino-1,3-thiazolidin-4-one |
| SMILES | C=CCN1C(=O)C(=C2Sc3ccc(OC)cc3N2C)S/C1=N/c1cccc2ncccc12 |
| InChI | InChI=1S/C24H20N4O2S2/c1-4-13-28-22(29)21(23-27(2)19-14-15(30-3)10-11-20(19)31-23)32-24(28)26-18-9-5-8-17-16(18)7-6-12-25-17/h4-12,14H,1,13H2,2-3H3/b23-21?,26-24+ |
| InChIKey | PWCYSCQQVJFKAB-RAYJIRAGSA-N |
| XLogP | 5.40 |
| TPSA | 58.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.58 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|