C23H18N4OS2 — CID 3823002
5-(3-methyl-1,3-benzothiazol-2-ylidene)-3-prop-2-enyl-2-quinolin-5-ylimino-1,3-thiazolidin-4-one (PubChem CID 3823002) has the molecular formula C23H18N4OS2 and a molecular weight of 430.56 g/mol. Its IUPAC name is 5-(3-methyl-1,3-benzothiazol-2-ylidene)-3-prop-2-enyl-2-quinolin-5-ylimino-1,3-thiazolidin-4-one.
| Compound Name | 5-(3-methyl-1,3-benzothiazol-2-ylidene)-3-prop-2-enyl-2-quinolin-5-ylimino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 3823002 |
| Molecular Formula | C23H18N4OS2 |
| Molecular Weight | 430.56 g/mol |
| Exact Mass | 430.09 |
| IUPAC Name | 5-(3-methyl-1,3-benzothiazol-2-ylidene)-3-prop-2-enyl-2-quinolin-5-ylimino-1,3-thiazolidin-4-one |
| SMILES | C=CCN1C(=O)C(=C2Sc3ccccc3N2C)S/C1=N/c1cccc2ncccc12 |
| InChI | InChI=1S/C23H18N4OS2/c1-3-14-27-21(28)20(22-26(2)18-11-4-5-12-19(18)29-22)30-23(27)25-17-10-6-9-16-15(17)8-7-13-24-16/h3-13H,1,14H2,2H3/b22-20?,25-23+ |
| InChIKey | XHBNXJZTCBXPRU-XXUSLJSDSA-N |
| XLogP | 5.39 |
| TPSA | 48.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.56 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|