C27H19ClN4OS2 — CID 6176284
(5Z)-5-(5-chloro-3-methyl-1,3-benzothiazol-2-ylidene)-3-(3-methylphenyl)-2-quinolin-5-ylimino-1,3-thiazolidin-4-one (PubChem CID 6176284) has the molecular formula C27H19ClN4OS2 and a molecular weight of 515.06 g/mol. Its IUPAC name is (5Z)-5-(5-chloro-3-methyl-1,3-benzothiazol-2-ylidene)-3-(3-methylphenyl)-2-quinolin-5-ylimino-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-5-(5-chloro-3-methyl-1,3-benzothiazol-2-ylidene)-3-(3-methylphenyl)-2-quinolin-5-ylimino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 6176284 |
| Molecular Formula | C27H19ClN4OS2 |
| Molecular Weight | 515.06 g/mol |
| Exact Mass | 514.07 |
| IUPAC Name | (5Z)-5-(5-chloro-3-methyl-1,3-benzothiazol-2-ylidene)-3-(3-methylphenyl)-2-quinolin-5-ylimino-1,3-thiazolidin-4-one |
| SMILES | Cc1cccc(N2C(=O)/C(=C3/Sc4ccc(Cl)cc4N3C)S/C2=N\c2cccc3ncccc23)c1 |
| InChI | InChI=1S/C27H19ClN4OS2/c1-16-6-3-7-18(14-16)32-25(33)24(26-31(2)22-15-17(28)11-12-23(22)34-26)35-27(32)30-21-10-4-9-20-19(21)8-5-13-29-20/h3-15H,1-2H3/b26-24-,30-27- |
| InChIKey | RTCDFTWVMBTMKR-SSEVLGFUSA-N |
| XLogP | 7.38 |
| TPSA | 48.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.06 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|