C28H27ClN4OS2 — CID 3470844
5-(5-chloro-3-methyl-1,3-benzothiazol-2-ylidene)-2-[4-(diethylamino)phenyl]imino-3-(3-methylphenyl)-1,3-thiazolidin-4-one (PubChem CID 3470844) has the molecular formula C28H27ClN4OS2 and a molecular weight of 535.14 g/mol. Its IUPAC name is 5-(5-chloro-3-methyl-1,3-benzothiazol-2-ylidene)-2-[4-(diethylamino)phenyl]imino-3-(3-methylphenyl)-1,3-thiazolidin-4-one.
| Compound Name | 5-(5-chloro-3-methyl-1,3-benzothiazol-2-ylidene)-2-[4-(diethylamino)phenyl]imino-3-(3-methylphenyl)-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 3470844 |
| Molecular Formula | C28H27ClN4OS2 |
| Molecular Weight | 535.14 g/mol |
| Exact Mass | 534.13 |
| IUPAC Name | 5-(5-chloro-3-methyl-1,3-benzothiazol-2-ylidene)-2-[4-(diethylamino)phenyl]imino-3-(3-methylphenyl)-1,3-thiazolidin-4-one |
| SMILES | CCN(CC)c1ccc(/N=C2\SC(=C3Sc4ccc(Cl)cc4N3C)C(=O)N2c2cccc(C)c2)cc1 |
| InChI | InChI=1S/C28H27ClN4OS2/c1-5-32(6-2)21-13-11-20(12-14-21)30-28-33(22-9-7-8-18(3)16-22)26(34)25(36-28)27-31(4)23-17-19(29)10-15-24(23)35-27/h7-17H,5-6H2,1-4H3/b27-25?,30-28- |
| InChIKey | QBCDXKUPOOAIKM-ATYUZXEASA-N |
| XLogP | 7.67 |
| TPSA | 39.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.14 |
| LogP ≤ 5 | 7.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|