C18H13Cl2N3OS2 — CID 3744972
5-(5-chloro-3-methyl-1,3-benzothiazol-2-ylidene)-2-(4-chlorophenyl)imino-3-methyl-1,3-thiazolidin-4-one (PubChem CID 3744972) has the molecular formula C18H13Cl2N3OS2 and a molecular weight of 422.36 g/mol. Its IUPAC name is 5-(5-chloro-3-methyl-1,3-benzothiazol-2-ylidene)-2-(4-chlorophenyl)imino-3-methyl-1,3-thiazolidin-4-one.
| Compound Name | 5-(5-chloro-3-methyl-1,3-benzothiazol-2-ylidene)-2-(4-chlorophenyl)imino-3-methyl-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 3744972 |
| Molecular Formula | C18H13Cl2N3OS2 |
| Molecular Weight | 422.36 g/mol |
| Exact Mass | 420.99 |
| IUPAC Name | 5-(5-chloro-3-methyl-1,3-benzothiazol-2-ylidene)-2-(4-chlorophenyl)imino-3-methyl-1,3-thiazolidin-4-one |
| SMILES | CN1C(=O)C(=C2Sc3ccc(Cl)cc3N2C)S/C1=N\c1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H13Cl2N3OS2/c1-22-13-9-11(20)5-8-14(13)25-17(22)15-16(24)23(2)18(26-15)21-12-6-3-10(19)4-7-12/h3-9H,1-2H3/b17-15?,21-18- |
| InChIKey | LKTQVTCWNPDUBY-XOZHESDMSA-N |
| XLogP | 5.60 |
| TPSA | 35.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.36 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|