C19H16ClN3O2S2 — CID 27806630
(5E)-2-(2-chlorophenyl)imino-5-(5-methoxy-3-methyl-1,3-benzothiazol-2-ylidene)-3-methyl-1,3-thiazolidin-4-one (PubChem CID 27806630) has the molecular formula C19H16ClN3O2S2 and a molecular weight of 417.94 g/mol. Its IUPAC name is (5E)-2-(2-chlorophenyl)imino-5-(5-methoxy-3-methyl-1,3-benzothiazol-2-ylidene)-3-methyl-1,3-thiazolidin-4-one.
| Compound Name | (5E)-2-(2-chlorophenyl)imino-5-(5-methoxy-3-methyl-1,3-benzothiazol-2-ylidene)-3-methyl-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 27806630 |
| Molecular Formula | C19H16ClN3O2S2 |
| Molecular Weight | 417.94 g/mol |
| Exact Mass | 417.04 |
| IUPAC Name | (5E)-2-(2-chlorophenyl)imino-5-(5-methoxy-3-methyl-1,3-benzothiazol-2-ylidene)-3-methyl-1,3-thiazolidin-4-one |
| SMILES | COc1ccc2c(c1)N(C)/C(=C1\S/C(=N\c3ccccc3Cl)N(C)C1=O)S2 |
| InChI | InChI=1S/C19H16ClN3O2S2/c1-22-14-10-11(25-3)8-9-15(14)26-18(22)16-17(24)23(2)19(27-16)21-13-7-5-4-6-12(13)20/h4-10H,1-3H3/b18-16+,21-19- |
| InChIKey | KSFALLYKLXUHET-DHZPKXATSA-N |
| XLogP | 4.95 |
| TPSA | 45.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.94 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|