C28H21N3O2S2 — CID 3358408
5-(5-methoxy-3-methyl-1,3-benzothiazol-2-ylidene)-2-naphthalen-1-ylimino-3-phenyl-1,3-thiazolidin-4-one (PubChem CID 3358408) has the molecular formula C28H21N3O2S2 and a molecular weight of 495.63 g/mol. Its IUPAC name is 5-(5-methoxy-3-methyl-1,3-benzothiazol-2-ylidene)-2-naphthalen-1-ylimino-3-phenyl-1,3-thiazolidin-4-one.
| Compound Name | 5-(5-methoxy-3-methyl-1,3-benzothiazol-2-ylidene)-2-naphthalen-1-ylimino-3-phenyl-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 3358408 |
| Molecular Formula | C28H21N3O2S2 |
| Molecular Weight | 495.63 g/mol |
| Exact Mass | 495.11 |
| IUPAC Name | 5-(5-methoxy-3-methyl-1,3-benzothiazol-2-ylidene)-2-naphthalen-1-ylimino-3-phenyl-1,3-thiazolidin-4-one |
| SMILES | COc1ccc2c(c1)N(C)C(=C1S/C(=N\c3cccc4ccccc34)N(c3ccccc3)C1=O)S2 |
| InChI | InChI=1S/C28H21N3O2S2/c1-30-23-17-20(33-2)15-16-24(23)34-27(30)25-26(32)31(19-11-4-3-5-12-19)28(35-25)29-22-14-8-10-18-9-6-7-13-21(18)22/h3-17H,1-2H3/b27-25?,29-28- |
| InChIKey | BDWBWRDETDVBEQ-FCYFMNRGSA-N |
| XLogP | 7.03 |
| TPSA | 45.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.63 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|